About 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine
5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine (PubChem CID 114793304) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine.
Molecular Properties
| Compound Name | 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine |
| PubChem CID | 114793304 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine |
| SMILES | CC(N)CCCc1nc2ccncc2n1C |
| InChI | InChI=1S/C12H18N4/c1-9(13)4-3-5-12-15-10-6-7-14-8-11(10)16(12)2/h6-9H,3-5,13H2,1-2H3 |
| InChIKey | WWQXLGMBCDVGFD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine?
The IUPAC name of 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine (CID 114793304) is 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine.
What is the SMILES notation for 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine?
The canonical SMILES for 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine is CC(N)CCCc1nc2ccncc2n1C.
What is the InChIKey of 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine?
The InChIKey is WWQXLGMBCDVGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-9(13)4-3-5-12-15-10-6-7-14-8-11(10)16(12)2/h6-9H,3-5,13H2,1-2H3.
What are the key properties of 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine?
5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine has a molecular weight of 218.30 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylimidazo[4,5-c]pyridin-2-yl)pentan-2-amine is sourced from PubChem (CID 114793304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).