About 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine
2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine (PubChem CID 83858107) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine |
| PubChem CID | 83858107 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine |
| SMILES | CC(CN)c1nc2ccncc2n1C |
| InChI | InChI=1S/C10H14N4/c1-7(5-11)10-13-8-3-4-12-6-9(8)14(10)2/h3-4,6-7H,5,11H2,1-2H3 |
| InChIKey | NBWHTHKTIPUGRO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine?
The IUPAC name of 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine (CID 83858107) is 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine.
What is the SMILES notation for 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine?
The canonical SMILES for 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine is CC(CN)c1nc2ccncc2n1C.
What is the InChIKey of 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine?
The InChIKey is NBWHTHKTIPUGRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-7(5-11)10-13-8-3-4-12-6-9(8)14(10)2/h3-4,6-7H,5,11H2,1-2H3.
What are the key properties of 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine?
2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine has a molecular weight of 190.25 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylimidazo[4,5-c]pyridin-2-yl)propan-1-amine is sourced from PubChem (CID 83858107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).