C11H12ClN3O2 — CID 79292098
methyl 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]propanoate (PubChem CID 79292098) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is methyl 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]propanoate.
| Compound Name | methyl 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]propanoate |
|---|---|
| PubChem CID | 79292098 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | methyl 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]propanoate |
| SMILES | COC(=O)CCn1c(CCl)nc2cnccc21 |
| InChI | InChI=1S/C11H12ClN3O2/c1-17-11(16)3-5-15-9-2-4-13-7-8(9)14-10(15)6-12/h2,4,7H,3,5-6H2,1H3 |
| InChIKey | UORKPPCEYZFXOD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|