C12H15ClN4O2 — CID 113405656
2-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 113405656) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 113405656 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1c(CCl)nc2cnccc21 |
| InChI | InChI=1S/C12H15ClN4O2/c1-19-5-4-15-12(18)8-17-10-2-3-14-7-9(10)16-11(17)6-13/h2-3,7H,4-6,8H2,1H3,(H,15,18) |
| InChIKey | HIKRCRACRRXJOY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|