C13H18ClN3O — CID 79291828
2-(2-chloroethyl)-1-(4-methoxybutyl)imidazo[4,5-c]pyridine (PubChem CID 79291828) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(4-methoxybutyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(2-chloroethyl)-1-(4-methoxybutyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79291828 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(2-chloroethyl)-1-(4-methoxybutyl)imidazo[4,5-c]pyridine |
| SMILES | COCCCCn1c(CCCl)nc2cnccc21 |
| InChI | InChI=1S/C13H18ClN3O/c1-18-9-3-2-8-17-12-5-7-15-10-11(12)16-13(17)4-6-14/h5,7,10H,2-4,6,8-9H2,1H3 |
| InChIKey | GUMPUCHTRQUPSB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|