C13H19ClN4 — CID 79292261
2-[2-(2-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N-ethyl-N-methylethanamine (PubChem CID 79292261) has the molecular formula C13H19ClN4 and a molecular weight of 266.78 g/mol. Its IUPAC name is 2-[2-(2-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N-ethyl-N-methylethanamine.
| Compound Name | 2-[2-(2-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N-ethyl-N-methylethanamine |
|---|---|
| PubChem CID | 79292261 |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[2-(2-chloroethyl)imidazo[4,5-c]pyridin-1-yl]-N-ethyl-N-methylethanamine |
| SMILES | CCN(C)CCn1c(CCCl)nc2cnccc21 |
| InChI | InChI=1S/C13H19ClN4/c1-3-17(2)8-9-18-12-5-7-15-10-11(12)16-13(18)4-6-14/h5,7,10H,3-4,6,8-9H2,1-2H3 |
| InChIKey | MYHUJWBKXUJPDC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|