C15H22ClN3 — CID 83143728
2-(2-chloroethyl)-1-(2,3,3-trimethylbutyl)imidazo[4,5-c]pyridine (PubChem CID 83143728) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(2,3,3-trimethylbutyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(2-chloroethyl)-1-(2,3,3-trimethylbutyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 83143728 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(2-chloroethyl)-1-(2,3,3-trimethylbutyl)imidazo[4,5-c]pyridine |
| SMILES | CC(Cn1c(CCCl)nc2cnccc21)C(C)(C)C |
| InChI | InChI=1S/C15H22ClN3/c1-11(15(2,3)4)10-19-13-6-8-17-9-12(13)18-14(19)5-7-16/h6,8-9,11H,5,7,10H2,1-4H3 |
| InChIKey | IYMXUNCBUBWBSU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|