C14H14ClN3O — CID 79291836
2-(2-chloroethyl)-1-[(5-methylfuran-2-yl)methyl]imidazo[4,5-c]pyridine (PubChem CID 79291836) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-[(5-methylfuran-2-yl)methyl]imidazo[4,5-c]pyridine.
| Compound Name | 2-(2-chloroethyl)-1-[(5-methylfuran-2-yl)methyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79291836 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(2-chloroethyl)-1-[(5-methylfuran-2-yl)methyl]imidazo[4,5-c]pyridine |
| SMILES | Cc1ccc(Cn2c(CCCl)nc3cnccc32)o1 |
| InChI | InChI=1S/C14H14ClN3O/c1-10-2-3-11(19-10)9-18-13-5-7-16-8-12(13)17-14(18)4-6-15/h2-3,5,7-8H,4,6,9H2,1H3 |
| InChIKey | IMBVBVRZTNOJLG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|