C12H16ClN5 — CID 83018792
2-(chloromethyl)-1-(4-methylpiperazin-1-yl)imidazo[4,5-c]pyridine (PubChem CID 83018792) has the molecular formula C12H16ClN5 and a molecular weight of 265.75 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(4-methylpiperazin-1-yl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(chloromethyl)-1-(4-methylpiperazin-1-yl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 83018792 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(chloromethyl)-1-(4-methylpiperazin-1-yl)imidazo[4,5-c]pyridine |
| SMILES | CN1CCN(n2c(CCl)nc3cnccc32)CC1 |
| InChI | InChI=1S/C12H16ClN5/c1-16-4-6-17(7-5-16)18-11-2-3-14-9-10(11)15-12(18)8-13/h2-3,9H,4-8H2,1H3 |
| InChIKey | GNXMKXYKHLVXPV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|