C14H13ClN4 — CID 79292162
2-(chloromethyl)-1-(1-pyridin-3-ylethyl)imidazo[4,5-c]pyridine (PubChem CID 79292162) has the molecular formula C14H13ClN4 and a molecular weight of 272.74 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(1-pyridin-3-ylethyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(chloromethyl)-1-(1-pyridin-3-ylethyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 79292162 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-(chloromethyl)-1-(1-pyridin-3-ylethyl)imidazo[4,5-c]pyridine |
| SMILES | CC(c1cccnc1)n1c(CCl)nc2cnccc21 |
| InChI | InChI=1S/C14H13ClN4/c1-10(11-3-2-5-16-8-11)19-13-4-6-17-9-12(13)18-14(19)7-15/h2-6,8-10H,7H2,1H3 |
| InChIKey | XTVPJSZTQQKBAC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|