C11H14ClN3 — CID 130597335
3-butan-2-yl-2-(chloromethyl)imidazo[4,5-c]pyridine (PubChem CID 130597335) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 3-butan-2-yl-2-(chloromethyl)imidazo[4,5-c]pyridine.
| Compound Name | 3-butan-2-yl-2-(chloromethyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 130597335 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 3-butan-2-yl-2-(chloromethyl)imidazo[4,5-c]pyridine |
| SMILES | CCC(C)n1c(CCl)nc2ccncc21 |
| InChI | InChI=1S/C11H14ClN3/c1-3-8(2)15-10-7-13-5-4-9(10)14-11(15)6-12/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | JCSLQMDLZZWZTG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|