C9H9ClFN3 — CID 126984980
2-(chloromethyl)-3-(2-fluoroethyl)imidazo[4,5-c]pyridine (PubChem CID 126984980) has the molecular formula C9H9ClFN3 and a molecular weight of 213.64 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(2-fluoroethyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(chloromethyl)-3-(2-fluoroethyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 126984980 |
| Molecular Formula | C9H9ClFN3 |
| Molecular Weight | 213.64 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-(chloromethyl)-3-(2-fluoroethyl)imidazo[4,5-c]pyridine |
| SMILES | FCCn1c(CCl)nc2ccncc21 |
| InChI | InChI=1S/C9H9ClFN3/c10-5-9-13-7-1-3-12-6-8(7)14(9)4-2-11/h1,3,6H,2,4-5H2 |
| InChIKey | WCCYSJIXIJTEMX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|