C11H10ClF3N2 — CID 63226848
2-(chloromethyl)-1-(3,3,3-trifluoropropyl)benzimidazole (PubChem CID 63226848) has the molecular formula C11H10ClF3N2 and a molecular weight of 262.66 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(3,3,3-trifluoropropyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-1-(3,3,3-trifluoropropyl)benzimidazole |
|---|---|
| PubChem CID | 63226848 |
| Molecular Formula | C11H10ClF3N2 |
| Molecular Weight | 262.66 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-(chloromethyl)-1-(3,3,3-trifluoropropyl)benzimidazole |
| SMILES | FC(F)(F)CCn1c(CCl)nc2ccccc21 |
| InChI | InChI=1S/C11H10ClF3N2/c12-7-10-16-8-3-1-2-4-9(8)17(10)6-5-11(13,14)15/h1-4H,5-7H2 |
| InChIKey | SFMHNLWAFJFKQE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|