C13H12ClF3N2O — CID 115521867
2-(chloromethyl)-3-(4,4,4-trifluorobutyl)quinazolin-4-one (PubChem CID 115521867) has the molecular formula C13H12ClF3N2O and a molecular weight of 304.70 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(4,4,4-trifluorobutyl)quinazolin-4-one.
| Compound Name | 2-(chloromethyl)-3-(4,4,4-trifluorobutyl)quinazolin-4-one |
|---|---|
| PubChem CID | 115521867 |
| Molecular Formula | C13H12ClF3N2O |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(chloromethyl)-3-(4,4,4-trifluorobutyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(CCl)n1CCCC(F)(F)F |
| InChI | InChI=1S/C13H12ClF3N2O/c14-8-11-18-10-5-2-1-4-9(10)12(20)19(11)7-3-6-13(15,16)17/h1-2,4-5H,3,6-8H2 |
| InChIKey | SHDZYKDBOVKVDT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|