C13H14F3N3S — CID 115518301
2-[1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]ethanethioamide (PubChem CID 115518301) has the molecular formula C13H14F3N3S and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]ethanethioamide.
| Compound Name | 2-[1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]ethanethioamide |
|---|---|
| PubChem CID | 115518301 |
| Molecular Formula | C13H14F3N3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-[1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]ethanethioamide |
| SMILES | NC(=S)Cc1nc2ccccc2n1CCCC(F)(F)F |
| InChI | InChI=1S/C13H14F3N3S/c14-13(15,16)6-3-7-19-10-5-2-1-4-9(10)18-12(19)8-11(17)20/h1-2,4-5H,3,6-8H2,(H2,17,20) |
| InChIKey | HBASWKFZSMMIRD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|