C13H15F3N4O — CID 115518307
N'-hydroxy-2-[1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]ethanimidamide (PubChem CID 115518307) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is N'-hydroxy-2-[1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 115518307 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N'-hydroxy-2-[1-(4,4,4-trifluorobutyl)benzimidazol-2-yl]ethanimidamide |
| SMILES | N/C(Cc1nc2ccccc2n1CCCC(F)(F)F)=N/O |
| InChI | InChI=1S/C13H15F3N4O/c14-13(15,16)6-3-7-20-10-5-2-1-4-9(10)18-12(20)8-11(17)19-21/h1-2,4-5,21H,3,6-8H2,(H2,17,19) |
| InChIKey | RYXDBFILUDNYJD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|