C14H19N3O2S2 — CID 65096873
2-[1-(3-ethylsulfonylpropyl)benzimidazol-2-yl]ethanethioamide (PubChem CID 65096873) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-[1-(3-ethylsulfonylpropyl)benzimidazol-2-yl]ethanethioamide.
| Compound Name | 2-[1-(3-ethylsulfonylpropyl)benzimidazol-2-yl]ethanethioamide |
|---|---|
| PubChem CID | 65096873 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-[1-(3-ethylsulfonylpropyl)benzimidazol-2-yl]ethanethioamide |
| SMILES | CCS(=O)(=O)CCCn1c(CC(N)=S)nc2ccccc21 |
| InChI | InChI=1S/C14H19N3O2S2/c1-2-21(18,19)9-5-8-17-12-7-4-3-6-11(12)16-14(17)10-13(15)20/h3-4,6-7H,2,5,8-10H2,1H3,(H2,15,20) |
| InChIKey | NDQIZUGEOLCXLK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|