C14H21N5O — CID 114526601
2-[1-[3-(dimethylamino)propyl]benzimidazol-2-yl]-N'-hydroxyethanimidamide (PubChem CID 114526601) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 2-[1-[3-(dimethylamino)propyl]benzimidazol-2-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[3-(dimethylamino)propyl]benzimidazol-2-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 114526601 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-[1-[3-(dimethylamino)propyl]benzimidazol-2-yl]-N'-hydroxyethanimidamide |
| SMILES | CN(C)CCCn1c(C/C(N)=N/O)nc2ccccc21 |
| InChI | InChI=1S/C14H21N5O/c1-18(2)8-5-9-19-12-7-4-3-6-11(12)16-14(19)10-13(15)17-20/h3-4,6-7,20H,5,8-10H2,1-2H3,(H2,15,17) |
| InChIKey | CATZWYUEFUKAEM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|