C12H13ClF2N2O — CID 114128388
2-(chloromethyl)-1-[2-(2,2-difluoroethoxy)ethyl]benzimidazole (PubChem CID 114128388) has the molecular formula C12H13ClF2N2O and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[2-(2,2-difluoroethoxy)ethyl]benzimidazole.
| Compound Name | 2-(chloromethyl)-1-[2-(2,2-difluoroethoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 114128388 |
| Molecular Formula | C12H13ClF2N2O |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-(chloromethyl)-1-[2-(2,2-difluoroethoxy)ethyl]benzimidazole |
| SMILES | FC(F)COCCn1c(CCl)nc2ccccc21 |
| InChI | InChI=1S/C12H13ClF2N2O/c13-7-12-16-9-3-1-2-4-10(9)17(12)5-6-18-8-11(14)15/h1-4,11H,5-8H2 |
| InChIKey | LTLRHMHUXLCUOE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|