C15H20F2N2O2 — CID 103147708
4-(2,2-difluoroethoxy)-1-(1-ethylbenzimidazol-2-yl)butan-2-ol (PubChem CID 103147708) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1-(1-ethylbenzimidazol-2-yl)butan-2-ol.
| Compound Name | 4-(2,2-difluoroethoxy)-1-(1-ethylbenzimidazol-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 103147708 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1-(1-ethylbenzimidazol-2-yl)butan-2-ol |
| SMILES | CCn1c(CC(O)CCOCC(F)F)nc2ccccc21 |
| InChI | InChI=1S/C15H20F2N2O2/c1-2-19-13-6-4-3-5-12(13)18-15(19)9-11(20)7-8-21-10-14(16)17/h3-6,11,14,20H,2,7-10H2,1H3 |
| InChIKey | AEPNMHAYTIWRHZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|