C17H20N2O2 — CID 105111628
1-(1-ethylbenzimidazol-2-yl)-4-(furan-2-yl)butan-2-ol (PubChem CID 105111628) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(1-ethylbenzimidazol-2-yl)-4-(furan-2-yl)butan-2-ol.
| Compound Name | 1-(1-ethylbenzimidazol-2-yl)-4-(furan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 105111628 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(1-ethylbenzimidazol-2-yl)-4-(furan-2-yl)butan-2-ol |
| SMILES | CCn1c(CC(O)CCc2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C17H20N2O2/c1-2-19-16-8-4-3-7-15(16)18-17(19)12-13(20)9-10-14-6-5-11-21-14/h3-8,11,13,20H,2,9-10,12H2,1H3 |
| InChIKey | UMMCRXXWSYGALK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |