C16H24N2O3 — CID 79756098
1,1-diethoxy-3-(1-ethylbenzimidazol-2-yl)propan-2-ol (PubChem CID 79756098) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1,1-diethoxy-3-(1-ethylbenzimidazol-2-yl)propan-2-ol.
| Compound Name | 1,1-diethoxy-3-(1-ethylbenzimidazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 79756098 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1,1-diethoxy-3-(1-ethylbenzimidazol-2-yl)propan-2-ol |
| SMILES | CCOC(OCC)C(O)Cc1nc2ccccc2n1CC |
| InChI | InChI=1S/C16H24N2O3/c1-4-18-13-10-8-7-9-12(13)17-15(18)11-14(19)16(20-5-2)21-6-3/h7-10,14,16,19H,4-6,11H2,1-3H3 |
| InChIKey | ZTAILWFNQHIRJD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|