C15H22N2O3 — CID 79753376
1,1-diethoxy-3-(1-methylbenzimidazol-2-yl)propan-2-ol (PubChem CID 79753376) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1,1-diethoxy-3-(1-methylbenzimidazol-2-yl)propan-2-ol.
| Compound Name | 1,1-diethoxy-3-(1-methylbenzimidazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 79753376 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1,1-diethoxy-3-(1-methylbenzimidazol-2-yl)propan-2-ol |
| SMILES | CCOC(OCC)C(O)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C15H22N2O3/c1-4-19-15(20-5-2)13(18)10-14-16-11-8-6-7-9-12(11)17(14)3/h6-9,13,15,18H,4-5,10H2,1-3H3 |
| InChIKey | HCPCWMOXTJFQPM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|