C13H18N2O2 — CID 103454668
1-(1-methylbenzimidazol-2-yl)pentane-2,3-diol (PubChem CID 103454668) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(1-methylbenzimidazol-2-yl)pentane-2,3-diol.
| Compound Name | 1-(1-methylbenzimidazol-2-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 103454668 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(1-methylbenzimidazol-2-yl)pentane-2,3-diol |
| SMILES | CCC(O)C(O)Cc1nc2ccccc2n1C |
| InChI | InChI=1S/C13H18N2O2/c1-3-11(16)12(17)8-13-14-9-6-4-5-7-10(9)15(13)2/h4-7,11-12,16-17H,3,8H2,1-2H3 |
| InChIKey | WZYYWZFJXIERBZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |