C11H9ClF4N2 — CID 141387694
2-(chloromethyl)-7-fluoro-1-(3,3,3-trifluoropropyl)benzimidazole (PubChem CID 141387694) has the molecular formula C11H9ClF4N2 and a molecular weight of 280.65 g/mol. Its IUPAC name is 2-(chloromethyl)-7-fluoro-1-(3,3,3-trifluoropropyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-7-fluoro-1-(3,3,3-trifluoropropyl)benzimidazole |
|---|---|
| PubChem CID | 141387694 |
| Molecular Formula | C11H9ClF4N2 |
| Molecular Weight | 280.65 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-(chloromethyl)-7-fluoro-1-(3,3,3-trifluoropropyl)benzimidazole |
| SMILES | Fc1cccc2nc(CCl)n(CCC(F)(F)F)c12 |
| InChI | InChI=1S/C11H9ClF4N2/c12-6-9-17-8-3-1-2-7(13)10(8)18(9)5-4-11(14,15)16/h1-3H,4-6H2 |
| InChIKey | WRBNVJORAXAZLM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|