C14H15Cl2F3N2 — CID 115521089
7-chloro-2-(2-chloroethyl)-1-(5,5,5-trifluoropentyl)benzimidazole (PubChem CID 115521089) has the molecular formula C14H15Cl2F3N2 and a molecular weight of 339.19 g/mol. Its IUPAC name is 7-chloro-2-(2-chloroethyl)-1-(5,5,5-trifluoropentyl)benzimidazole.
| Compound Name | 7-chloro-2-(2-chloroethyl)-1-(5,5,5-trifluoropentyl)benzimidazole |
|---|---|
| PubChem CID | 115521089 |
| Molecular Formula | C14H15Cl2F3N2 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 7-chloro-2-(2-chloroethyl)-1-(5,5,5-trifluoropentyl)benzimidazole |
| SMILES | FC(F)(F)CCCCn1c(CCCl)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C14H15Cl2F3N2/c15-8-6-12-20-11-5-3-4-10(16)13(11)21(12)9-2-1-7-14(17,18)19/h3-5H,1-2,6-9H2 |
| InChIKey | DZOBLKWYSVBNGW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|