C14H17ClF3N3 — CID 115521123
2-(2-chloroethyl)-7-methyl-3-(5,5,5-trifluoropentyl)imidazo[4,5-b]pyridine (PubChem CID 115521123) has the molecular formula C14H17ClF3N3 and a molecular weight of 319.76 g/mol. Its IUPAC name is 2-(2-chloroethyl)-7-methyl-3-(5,5,5-trifluoropentyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-7-methyl-3-(5,5,5-trifluoropentyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 115521123 |
| Molecular Formula | C14H17ClF3N3 |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-(2-chloroethyl)-7-methyl-3-(5,5,5-trifluoropentyl)imidazo[4,5-b]pyridine |
| SMILES | Cc1ccnc2c1nc(CCCl)n2CCCCC(F)(F)F |
| InChI | InChI=1S/C14H17ClF3N3/c1-10-5-8-19-13-12(10)20-11(4-7-15)21(13)9-3-2-6-14(16,17)18/h5,8H,2-4,6-7,9H2,1H3 |
| InChIKey | PKHHSSMXPYFHSY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|