C10H12ClN3 — CID 79293422
2-(2-chloroethyl)-3,7-dimethylimidazo[4,5-b]pyridine (PubChem CID 79293422) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3,7-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-3,7-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 79293422 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(2-chloroethyl)-3,7-dimethylimidazo[4,5-b]pyridine |
| SMILES | Cc1ccnc2c1nc(CCCl)n2C |
| InChI | InChI=1S/C10H12ClN3/c1-7-4-6-12-10-9(7)13-8(3-5-11)14(10)2/h4,6H,3,5H2,1-2H3 |
| InChIKey | BCJPHWYESYFDOG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|