C13H13Cl2F3N2 — CID 104838552
4-chloro-2-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)benzimidazole (PubChem CID 104838552) has the molecular formula C13H13Cl2F3N2 and a molecular weight of 325.16 g/mol. Its IUPAC name is 4-chloro-2-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)benzimidazole.
| Compound Name | 4-chloro-2-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)benzimidazole |
|---|---|
| PubChem CID | 104838552 |
| Molecular Formula | C13H13Cl2F3N2 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-chloro-2-(2-chloroethyl)-1-(4,4,4-trifluorobutyl)benzimidazole |
| SMILES | FC(F)(F)CCCn1c(CCCl)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C13H13Cl2F3N2/c14-7-5-11-19-12-9(15)3-1-4-10(12)20(11)8-2-6-13(16,17)18/h1,3-4H,2,5-8H2 |
| InChIKey | LAABUWABDMEZPI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|