C13H12F2N2 — CID 61076812
2,3-difluoro-N-(2-pyridin-2-ylethyl)aniline (PubChem CID 61076812) has the molecular formula C13H12F2N2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-pyridin-2-ylethyl)aniline.
| Compound Name | 2,3-difluoro-N-(2-pyridin-2-ylethyl)aniline |
|---|---|
| PubChem CID | 61076812 |
| Molecular Formula | C13H12F2N2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2,3-difluoro-N-(2-pyridin-2-ylethyl)aniline |
| SMILES | Fc1cccc(NCCc2ccccn2)c1F |
| InChI | InChI=1S/C13H12F2N2/c14-11-5-3-6-12(13(11)15)17-9-7-10-4-1-2-8-16-10/h1-6,8,17H,7,9H2 |
| InChIKey | JZKSKYGQXJOJGZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |