methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate

C15H14F2N2O2 — CID 79834307

IUPACmethyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate
SMILESCOC(=O)c1ccc(NCCc2ccccn2)c(F)c1F
InChIInChI=1S/C15H14F2N2O2/c1-21-15(20)11-5-6-12(14(17)13(11)16)19-9-7-10-4-2-3-8-18-10/h2-6,8,19H,7,9H2,1H3
InChIKeyXMXZDQHESURGIX-UHFFFAOYSA-N
MW292.29 g/mol
LogP2.80
Rot. Bonds5

About methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate

methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate (PubChem CID 79834307) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate.

Molecular Properties

Compound Namemethyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate
PubChem CID79834307
Molecular FormulaC15H14F2N2O2
Molecular Weight292.29 g/mol
Exact Mass292.10
IUPAC Namemethyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate
SMILESCOC(=O)c1ccc(NCCc2ccccn2)c(F)c1F
InChIInChI=1S/C15H14F2N2O2/c1-21-15(20)11-5-6-12(14(17)13(11)16)19-9-7-10-4-2-3-8-18-10/h2-6,8,19H,7,9H2,1H3
InChIKeyXMXZDQHESURGIX-UHFFFAOYSA-N
XLogP2.80
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.29
LogP ≤ 52.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate?
The IUPAC name of methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate (CID 79834307) is methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate.
What is the SMILES notation for methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate?
The canonical SMILES for methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate is COC(=O)c1ccc(NCCc2ccccn2)c(F)c1F.
What is the InChIKey of methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate?
The InChIKey is XMXZDQHESURGIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2O2/c1-21-15(20)11-5-6-12(14(17)13(11)16)19-9-7-10-4-2-3-8-18-10/h2-6,8,19H,7,9H2,1H3.
What are the key properties of methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate?
methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate has a molecular weight of 292.29 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-difluoro-4-(2-pyridin-2-ylethylamino)benzoate is sourced from PubChem (CID 79834307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).