C13H17F2NO3 — CID 104762460
methyl 2,3-difluoro-4-(2-propan-2-yloxyethylamino)benzoate (PubChem CID 104762460) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is methyl 2,3-difluoro-4-(2-propan-2-yloxyethylamino)benzoate.
| Compound Name | methyl 2,3-difluoro-4-(2-propan-2-yloxyethylamino)benzoate |
|---|---|
| PubChem CID | 104762460 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | methyl 2,3-difluoro-4-(2-propan-2-yloxyethylamino)benzoate |
| SMILES | COC(=O)c1ccc(NCCOC(C)C)c(F)c1F |
| InChI | InChI=1S/C13H17F2NO3/c1-8(2)19-7-6-16-10-5-4-9(13(17)18-3)11(14)12(10)15/h4-5,8,16H,6-7H2,1-3H3 |
| InChIKey | ORSGLRKTTJDBSX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|