About methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate
methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate (PubChem CID 106404797) has the molecular formula C14H17F2NO3
and a molecular weight of 285.29 g/mol. Its IUPAC name is methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate |
| PubChem CID | 106404797 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate |
| SMILES | C=CCCOCCNc1ccc(C(=O)OC)c(F)c1F |
| InChI | InChI=1S/C14H17F2NO3/c1-3-4-8-20-9-7-17-11-6-5-10(14(18)19-2)12(15)13(11)16/h3,5-6,17H,1,4,7-9H2,2H3 |
| InChIKey | XHCFCGHRXGKDAI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate?
The IUPAC name of methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate (CID 106404797) is methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate.
What is the SMILES notation for methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate?
The canonical SMILES for methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate is C=CCCOCCNc1ccc(C(=O)OC)c(F)c1F.
What is the InChIKey of methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate?
The InChIKey is XHCFCGHRXGKDAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO3/c1-3-4-8-20-9-7-17-11-6-5-10(14(18)19-2)12(15)13(11)16/h3,5-6,17H,1,4,7-9H2,2H3.
What are the key properties of methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate?
methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate has a molecular weight of 285.29 g/mol, XLogP of 2.76, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate is sourced from PubChem (CID 106404797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).