C14H17F2NO3 — CID 106404797
methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate (PubChem CID 106404797) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate.
| Compound Name | methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 106404797 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 4-(2-but-3-enoxyethylamino)-2,3-difluorobenzoate |
| SMILES | C=CCCOCCNc1ccc(C(=O)OC)c(F)c1F |
| InChI | InChI=1S/C14H17F2NO3/c1-3-4-8-20-9-7-17-11-6-5-10(14(18)19-2)12(15)13(11)16/h3,5-6,17H,1,4,7-9H2,2H3 |
| InChIKey | XHCFCGHRXGKDAI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|