C14H12BrF3N2 — CID 60864182
4-bromo-N-(2-pyridin-2-ylethyl)-2-(trifluoromethyl)aniline (PubChem CID 60864182) has the molecular formula C14H12BrF3N2 and a molecular weight of 345.16 g/mol. Its IUPAC name is 4-bromo-N-(2-pyridin-2-ylethyl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-bromo-N-(2-pyridin-2-ylethyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 60864182 |
| Molecular Formula | C14H12BrF3N2 |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 4-bromo-N-(2-pyridin-2-ylethyl)-2-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(Br)ccc1NCCc1ccccn1 |
| InChI | InChI=1S/C14H12BrF3N2/c15-10-4-5-13(12(9-10)14(16,17)18)20-8-6-11-3-1-2-7-19-11/h1-5,7,9,20H,6,8H2 |
| InChIKey | XPMVKJKXNHNCET-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |