C13H15IN4O — CID 137008406
4-[(1-amino-3-phenylpropan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 137008406) has the molecular formula C13H15IN4O and a molecular weight of 370.19 g/mol. Its IUPAC name is 4-[(1-amino-3-phenylpropan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-amino-3-phenylpropan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137008406 |
| Molecular Formula | C13H15IN4O |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 4-[(1-amino-3-phenylpropan-2-yl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | NCC(Cc1ccccc1)Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C13H15IN4O/c14-11-12(16-8-17-13(11)19)18-10(7-15)6-9-4-2-1-3-5-9/h1-5,8,10H,6-7,15H2,(H2,16,17,18,19) |
| InChIKey | XTYCEQYDVGCPMU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|