C12H12IN3O2 — CID 136956079
4-[(2-hydroxy-2-phenylethyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136956079) has the molecular formula C12H12IN3O2 and a molecular weight of 357.15 g/mol. Its IUPAC name is 4-[(2-hydroxy-2-phenylethyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-hydroxy-2-phenylethyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956079 |
| Molecular Formula | C12H12IN3O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 4-[(2-hydroxy-2-phenylethyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC(O)c2ccccc2)c1I |
| InChI | InChI=1S/C12H12IN3O2/c13-10-11(15-7-16-12(10)18)14-6-9(17)8-4-2-1-3-5-8/h1-5,7,9,17H,6H2,(H2,14,15,16,18) |
| InChIKey | PKUPFEZUCVJUEQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|