About CID 170789185
CID 170789185 (PubChem CID 170789185) has the molecular formula C14H12BFN2O3
and a molecular weight of 286.07 g/mol.
Molecular Properties
| Compound Name | CID 170789185 |
| PubChem CID | 170789185 |
| Molecular Formula | C14H12BFN2O3 |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(-c2ccccc2F)n(CC(=O)OCC)c1=O |
| InChI | InChI=1S/C14H12BFN2O3/c1-2-21-12(19)8-18-13(17-7-10(15)14(18)20)9-5-3-4-6-11(9)16/h3-7H,2,8H2,1H3 |
| InChIKey | ZYHVWEVJFBXKAF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170789185 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170789185?
The IUPAC name of CID 170789185 (CID 170789185) is not available.
What is the SMILES notation for CID 170789185?
The canonical SMILES for CID 170789185 is [B]c1cnc(-c2ccccc2F)n(CC(=O)OCC)c1=O.
What is the InChIKey of CID 170789185?
The InChIKey is ZYHVWEVJFBXKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BFN2O3/c1-2-21-12(19)8-18-13(17-7-10(15)14(18)20)9-5-3-4-6-11(9)16/h3-7H,2,8H2,1H3.
What are the key properties of CID 170789185?
CID 170789185 has a molecular weight of 286.07 g/mol, XLogP of 0.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170789185 is sourced from PubChem (CID 170789185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).