C11H13F2NO3 — CID 133103382
ethyl 2-[5-(difluoromethyl)-3-methyl-2-oxo-1H-pyridin-4-yl]acetate (PubChem CID 133103382) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is ethyl 2-[5-(difluoromethyl)-3-methyl-2-oxo-1H-pyridin-4-yl]acetate.
| Compound Name | ethyl 2-[5-(difluoromethyl)-3-methyl-2-oxo-1H-pyridin-4-yl]acetate |
|---|---|
| PubChem CID | 133103382 |
| Molecular Formula | C11H13F2NO3 |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | ethyl 2-[5-(difluoromethyl)-3-methyl-2-oxo-1H-pyridin-4-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C(F)F)c[nH]c(=O)c1C |
| InChI | InChI=1S/C11H13F2NO3/c1-3-17-9(15)4-7-6(2)11(16)14-5-8(7)10(12)13/h5,10H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | QZLFRRFRLSOHHH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |