C9H8F2INO3 — CID 133103615
ethyl 5-(difluoromethyl)-3-iodo-2-oxo-1H-pyridine-4-carboxylate (PubChem CID 133103615) has the molecular formula C9H8F2INO3 and a molecular weight of 343.07 g/mol. Its IUPAC name is ethyl 5-(difluoromethyl)-3-iodo-2-oxo-1H-pyridine-4-carboxylate.
| Compound Name | ethyl 5-(difluoromethyl)-3-iodo-2-oxo-1H-pyridine-4-carboxylate |
|---|---|
| PubChem CID | 133103615 |
| Molecular Formula | C9H8F2INO3 |
| Molecular Weight | 343.07 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | ethyl 5-(difluoromethyl)-3-iodo-2-oxo-1H-pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)F)c[nH]c(=O)c1I |
| InChI | InChI=1S/C9H8F2INO3/c1-2-16-9(15)5-4(7(10)11)3-13-8(14)6(5)12/h3,7H,2H2,1H3,(H,13,14) |
| InChIKey | GYKDFOSEGFTYSZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.07 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|