C20H16N6O6 — CID 22100145
2-[6-nitro-2,3-dioxo-7-[3-[(pyridin-4-ylamino)methyl]pyrrol-1-yl]-4H-quinoxalin-1-yl]acetic acid (PubChem CID 22100145) has the molecular formula C20H16N6O6 and a molecular weight of 436.38 g/mol. Its IUPAC name is 2-[6-nitro-2,3-dioxo-7-[3-[(pyridin-4-ylamino)methyl]pyrrol-1-yl]-4H-quinoxalin-1-yl]acetic acid.
| Compound Name | 2-[6-nitro-2,3-dioxo-7-[3-[(pyridin-4-ylamino)methyl]pyrrol-1-yl]-4H-quinoxalin-1-yl]acetic acid |
|---|---|
| PubChem CID | 22100145 |
| Molecular Formula | C20H16N6O6 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[6-nitro-2,3-dioxo-7-[3-[(pyridin-4-ylamino)methyl]pyrrol-1-yl]-4H-quinoxalin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(=O)c(=O)[nH]c2cc([N+](=O)[O-])c(-n3ccc(CNc4ccncc4)c3)cc21 |
| InChI | InChI=1S/C20H16N6O6/c27-18(28)11-25-15-8-16(17(26(31)32)7-14(15)23-19(29)20(25)30)24-6-3-12(10-24)9-22-13-1-4-21-5-2-13/h1-8,10H,9,11H2,(H,21,22)(H,23,29)(H,27,28) |
| InChIKey | MFUCZAIJNZOUEI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 165.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|