C18H22N6O6 — CID 19101622
4-(1-azabicyclo[2.2.2]octan-3-yl)-6-imidazol-1-yl-7-nitro-1H-quinoxaline-2,3-dione;dihydrate (PubChem CID 19101622) has the molecular formula C18H22N6O6 and a molecular weight of 418.41 g/mol. Its IUPAC name is 4-(1-azabicyclo[2.2.2]octan-3-yl)-6-imidazol-1-yl-7-nitro-1H-quinoxaline-2,3-dione;dihydrate.
| Compound Name | 4-(1-azabicyclo[2.2.2]octan-3-yl)-6-imidazol-1-yl-7-nitro-1H-quinoxaline-2,3-dione;dihydrate |
|---|---|
| PubChem CID | 19101622 |
| Molecular Formula | C18H22N6O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 4-(1-azabicyclo[2.2.2]octan-3-yl)-6-imidazol-1-yl-7-nitro-1H-quinoxaline-2,3-dione;dihydrate |
| SMILES | O.O.O=c1[nH]c2cc([N+](=O)[O-])c(-n3ccnc3)cc2n(C2CN3CCC2CC3)c1=O |
| InChI | InChI=1S/C18H18N6O4.2H2O/c25-17-18(26)23(16-9-21-4-1-11(16)2-5-21)13-8-14(22-6-3-19-10-22)15(24(27)28)7-12(13)20-17;;/h3,6-8,10-11,16H,1-2,4-5,9H2,(H,20,25);2*1H2 |
| InChIKey | KRFUBZXOBFBFBZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 182.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|