C12H14ClN5O6 — CID 172968720
6-chloro-5-nitro-3-piperidin-4-yl-1H-benzimidazol-2-one;nitric acid (PubChem CID 172968720) has the molecular formula C12H14ClN5O6 and a molecular weight of 359.73 g/mol. Its IUPAC name is 6-chloro-5-nitro-3-piperidin-4-yl-1H-benzimidazol-2-one;nitric acid.
| Compound Name | 6-chloro-5-nitro-3-piperidin-4-yl-1H-benzimidazol-2-one;nitric acid |
|---|---|
| PubChem CID | 172968720 |
| Molecular Formula | C12H14ClN5O6 |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 6-chloro-5-nitro-3-piperidin-4-yl-1H-benzimidazol-2-one;nitric acid |
| SMILES | O=[N+]([O-])O.O=c1[nH]c2cc(Cl)c([N+](=O)[O-])cc2n1C1CCNCC1 |
| InChI | InChI=1S/C12H13ClN4O3.HNO3/c13-8-5-9-11(6-10(8)17(19)20)16(12(18)15-9)7-1-3-14-4-2-7;2-1(3)4/h5-7,14H,1-4H2,(H,15,18);(H,2,3,4) |
| InChIKey | VQSGRYJFCWTPKO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 156.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|