C7H4ClN3O3 — CID 14566226
5-chloro-6-nitro-1,3-dihydrobenzimidazol-2-one (PubChem CID 14566226) has the molecular formula C7H4ClN3O3 and a molecular weight of 213.58 g/mol. Its IUPAC name is 5-chloro-6-nitro-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-chloro-6-nitro-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 14566226 |
| Molecular Formula | C7H4ClN3O3 |
| Molecular Weight | 213.58 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | 5-chloro-6-nitro-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(Cl)c([N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C7H4ClN3O3/c8-3-1-4-5(10-7(12)9-4)2-6(3)11(13)14/h1-2H,(H2,9,10,12) |
| InChIKey | LMGOHSUBTHHMHD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.58 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|