C9H6ClN2O6P — CID 18184112
(7-chloro-6-nitro-2-oxo-1H-quinolin-3-yl)phosphonic acid (PubChem CID 18184112) has the molecular formula C9H6ClN2O6P and a molecular weight of 304.58 g/mol. Its IUPAC name is (7-chloro-6-nitro-2-oxo-1H-quinolin-3-yl)phosphonic acid.
| Compound Name | (7-chloro-6-nitro-2-oxo-1H-quinolin-3-yl)phosphonic acid |
|---|---|
| PubChem CID | 18184112 |
| Molecular Formula | C9H6ClN2O6P |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | (7-chloro-6-nitro-2-oxo-1H-quinolin-3-yl)phosphonic acid |
| SMILES | O=c1[nH]c2cc(Cl)c([N+](=O)[O-])cc2cc1P(=O)(O)O |
| InChI | InChI=1S/C9H6ClN2O6P/c10-5-3-6-4(1-7(5)12(14)15)2-8(9(13)11-6)19(16,17)18/h1-3H,(H,11,13)(H2,16,17,18) |
| InChIKey | FJOUADKZIMUAAD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|