C5H2Cl2N2O3 — CID 125483662
5,6-dichloro-3-nitro-1H-pyridin-2-one (PubChem CID 125483662) has the molecular formula C5H2Cl2N2O3 and a molecular weight of 208.99 g/mol. Its IUPAC name is 5,6-dichloro-3-nitro-1H-pyridin-2-one.
| Compound Name | 5,6-dichloro-3-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 125483662 |
| Molecular Formula | C5H2Cl2N2O3 |
| Molecular Weight | 208.99 g/mol |
| Exact Mass | 207.94 |
| IUPAC Name | 5,6-dichloro-3-nitro-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H2Cl2N2O3/c6-2-1-3(9(11)12)5(10)8-4(2)7/h1H,(H,8,10) |
| InChIKey | CDJOMYOUJJUGLD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.99 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|