About (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione
(5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 11833559) has the molecular formula C10H5Cl2N3O4
and a molecular weight of 302.07 g/mol. Its IUPAC name is (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione |
| PubChem CID | 11833559 |
| Molecular Formula | C10H5Cl2N3O4 |
| Molecular Weight | 302.07 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cc(Cl)c(Cl)cc2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C10H5Cl2N3O4/c11-5-1-4(8(15(18)19)3-6(5)12)2-7-9(16)14-10(17)13-7/h1-3H,(H2,13,14,16,17)/b7-2+ |
| InChIKey | DEGZJFCAISZPTO-FARCUNLSSA-N |
| XLogP | 2.08 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.07 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione?
The IUPAC name of (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione (CID 11833559) is (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione.
What is the SMILES notation for (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione?
The canonical SMILES for (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione is O=C1NC(=O)/C(=C\c2cc(Cl)c(Cl)cc2[N+](=O)[O-])N1.
What is the InChIKey of (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione?
The InChIKey is DEGZJFCAISZPTO-FARCUNLSSA-N. The full InChI is InChI=1S/C10H5Cl2N3O4/c11-5-1-4(8(15(18)19)3-6(5)12)2-7-9(16)14-10(17)13-7/h1-3H,(H2,13,14,16,17)/b7-2+.
What are the key properties of (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione?
(5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione has a molecular weight of 302.07 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-[(4,5-dichloro-2-nitrophenyl)methylidene]imidazolidine-2,4-dione is sourced from PubChem (CID 11833559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).