C10H7N3O4 — CID 5467828
(5E)-5-[(3-nitrophenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 5467828) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is (5E)-5-[(3-nitrophenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-nitrophenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5467828 |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (5E)-5-[(3-nitrophenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2cccc([N+](=O)[O-])c2)N1 |
| InChI | InChI=1S/C10H7N3O4/c14-9-8(11-10(15)12-9)5-6-2-1-3-7(4-6)13(16)17/h1-5H,(H2,11,12,14,15)/b8-5+ |
| InChIKey | UXLLZDWZJYMJKG-VMPITWQZSA-N |
| XLogP | 0.78 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|