C12H14N2O2 — CID 91247316
(5E)-5-benzylideneimidazolidine-2,4-dione;ethane (PubChem CID 91247316) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (5E)-5-benzylideneimidazolidine-2,4-dione;ethane.
| Compound Name | (5E)-5-benzylideneimidazolidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 91247316 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (5E)-5-benzylideneimidazolidine-2,4-dione;ethane |
| SMILES | CC.O=C1NC(=O)/C(=C\c2ccccc2)N1 |
| InChI | InChI=1S/C10H8N2O2.C2H6/c13-9-8(11-10(14)12-9)6-7-4-2-1-3-5-7;1-2/h1-6H,(H2,11,12,13,14);1-2H3/b8-6+; |
| InChIKey | NKPVMTLUYFKTKR-WVLIHFOGSA-N |
| XLogP | 1.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|