C12H13N3O2 — CID 745258
(5E)-5-[[4-(dimethylamino)phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 745258) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is (5E)-5-[[4-(dimethylamino)phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(dimethylamino)phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 745258 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (5E)-5-[[4-(dimethylamino)phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(/C=C2/NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C12H13N3O2/c1-15(2)9-5-3-8(4-6-9)7-10-11(16)14-12(17)13-10/h3-7H,1-2H3,(H2,13,14,16,17)/b10-7+ |
| InChIKey | KLVRHZIOWMWJOC-JXMROGBWSA-N |
| XLogP | 0.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|