C11H9N5O4 — CID 135503320
6-hydrazinylidene-5-[(3-nitrophenyl)methylidene]-1,3-diazinane-2,4-dione (PubChem CID 135503320) has the molecular formula C11H9N5O4 and a molecular weight of 275.22 g/mol. Its IUPAC name is 6-hydrazinylidene-5-[(3-nitrophenyl)methylidene]-1,3-diazinane-2,4-dione.
| Compound Name | 6-hydrazinylidene-5-[(3-nitrophenyl)methylidene]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 135503320 |
| Molecular Formula | C11H9N5O4 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 6-hydrazinylidene-5-[(3-nitrophenyl)methylidene]-1,3-diazinane-2,4-dione |
| SMILES | NN=C1NC(=O)NC(=O)C1=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9N5O4/c12-15-9-8(10(17)14-11(18)13-9)5-6-2-1-3-7(4-6)16(19)20/h1-5H,12H2,(H2,13,14,15,17,18) |
| InChIKey | CHXGWBODYFINCM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|